C10H15F2N5O2 — CID 86680003
6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine (PubChem CID 86680003) has the molecular formula C10H15F2N5O2 and a molecular weight of 275.26 g/mol. Its IUPAC name is 6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine.
| Compound Name | 6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine |
|---|---|
| PubChem CID | 86680003 |
| Molecular Formula | C10H15F2N5O2 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-amine |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(N)CC(F)(F)C1 |
| InChI | InChI=1S/C10H15F2N5O2/c1-15-9(8(5-14-15)17(18)19)16-3-2-7(13)4-10(11,12)6-16/h5,7H,2-4,6,13H2,1H3 |
| InChIKey | CSDYQJXUZSMVGV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|