C14H20F3N5O3 — CID 86658425
2,2,2-trifluoro-N-[(4R)-1-(4-nitro-1-propan-2-ylpyrazol-5-yl)azepan-4-yl]acetamide (PubChem CID 86658425) has the molecular formula C14H20F3N5O3 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4R)-1-(4-nitro-1-propan-2-ylpyrazol-5-yl)azepan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(4R)-1-(4-nitro-1-propan-2-ylpyrazol-5-yl)azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 86658425 |
| Molecular Formula | C14H20F3N5O3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4R)-1-(4-nitro-1-propan-2-ylpyrazol-5-yl)azepan-4-yl]acetamide |
| SMILES | CC(C)n1ncc([N+](=O)[O-])c1N1CCC[C@@H](NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H20F3N5O3/c1-9(2)21-12(11(8-18-21)22(24)25)20-6-3-4-10(5-7-20)19-13(23)14(15,16)17/h8-10H,3-7H2,1-2H3,(H,19,23)/t10-/m1/s1 |
| InChIKey | MECCFTSTFZSFHJ-SNVBAGLBSA-N |
| XLogP | 2.41 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|