C6H5F3N4O3 — CID 19990250
2,2,2-trifluoro-N-(1-methyl-4-nitropyrazol-5-yl)acetamide (PubChem CID 19990250) has the molecular formula C6H5F3N4O3 and a molecular weight of 238.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1-methyl-4-nitropyrazol-5-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1-methyl-4-nitropyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 19990250 |
| Molecular Formula | C6H5F3N4O3 |
| Molecular Weight | 238.12 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2,2,2-trifluoro-N-(1-methyl-4-nitropyrazol-5-yl)acetamide |
| SMILES | Cn1ncc([N+](=O)[O-])c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H5F3N4O3/c1-12-4(3(2-10-12)13(15)16)11-5(14)6(7,8)9/h2H,1H3,(H,11,14) |
| InChIKey | CJCJOIMDENAZCX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.12 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|