C14H18F5N5O3 — CID 86712990
N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 86712990) has the molecular formula C14H18F5N5O3 and a molecular weight of 399.32 g/mol. Its IUPAC name is N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 86712990 |
| Molecular Formula | C14H18F5N5O3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[(4R)-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-yl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CN(C(=O)C(F)(F)F)[C@@H]1CCCN(c2c([N+](=O)[O-])cnn2CC(F)F)CC1 |
| InChI | InChI=1S/C14H18F5N5O3/c1-21(13(25)14(17,18)19)9-3-2-5-22(6-4-9)12-10(24(26)27)7-20-23(12)8-11(15)16/h7,9,11H,2-6,8H2,1H3/t9-/m1/s1 |
| InChIKey | GTUOBHSHRUFIJY-SECBINFHSA-N |
| XLogP | 2.44 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|