C14H19F3N4O3 — CID 58464874
3-[(4S)-1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one (PubChem CID 58464874) has the molecular formula C14H19F3N4O3 and a molecular weight of 348.33 g/mol. Its IUPAC name is 3-[(4S)-1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-[(4S)-1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 58464874 |
| Molecular Formula | C14H19F3N4O3 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-[(4S)-1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-1,1,1-trifluoropropan-2-one |
| SMILES | CCn1ncc([N+](=O)[O-])c1N1CCC[C@H](CC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N4O3/c1-2-20-13(11(9-18-20)21(23)24)19-6-3-4-10(5-7-19)8-12(22)14(15,16)17/h9-10H,2-8H2,1H3/t10-/m0/s1 |
| InChIKey | UFOJOBOFKGZWNY-JTQLQIEISA-N |
| XLogP | 2.94 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|