C18H29N5O4 — CID 67436520
tert-butyl-[[1-[1-(cyclopropylmethyl)-4-nitropyrazol-5-yl]piperidin-4-yl]methyl]carbamic acid (PubChem CID 67436520) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is tert-butyl-[[1-[1-(cyclopropylmethyl)-4-nitropyrazol-5-yl]piperidin-4-yl]methyl]carbamic acid.
| Compound Name | tert-butyl-[[1-[1-(cyclopropylmethyl)-4-nitropyrazol-5-yl]piperidin-4-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 67436520 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl-[[1-[1-(cyclopropylmethyl)-4-nitropyrazol-5-yl]piperidin-4-yl]methyl]carbamic acid |
| SMILES | CC(C)(C)N(CC1CCN(c2c([N+](=O)[O-])cnn2CC2CC2)CC1)C(=O)O |
| InChI | InChI=1S/C18H29N5O4/c1-18(2,3)21(17(24)25)11-14-6-8-20(9-7-14)16-15(23(26)27)10-19-22(16)12-13-4-5-13/h10,13-14H,4-9,11-12H2,1-3H3,(H,24,25) |
| InChIKey | JUKUEJOLGZYAKY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|