C15H22F3N5O3 — CID 89480428
methylcyclopropane;2,2,2-trifluoro-N-[1-(4-nitro-1H-pyrazol-5-yl)azepan-4-yl]acetamide (PubChem CID 89480428) has the molecular formula C15H22F3N5O3 and a molecular weight of 377.37 g/mol. Its IUPAC name is methylcyclopropane;2,2,2-trifluoro-N-[1-(4-nitro-1H-pyrazol-5-yl)azepan-4-yl]acetamide.
| Compound Name | methylcyclopropane;2,2,2-trifluoro-N-[1-(4-nitro-1H-pyrazol-5-yl)azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 89480428 |
| Molecular Formula | C15H22F3N5O3 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | methylcyclopropane;2,2,2-trifluoro-N-[1-(4-nitro-1H-pyrazol-5-yl)azepan-4-yl]acetamide |
| SMILES | CC1CC1.O=C(NC1CCCN(c2[nH]ncc2[N+](=O)[O-])CC1)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N5O3.C4H8/c12-11(13,14)10(20)16-7-2-1-4-18(5-3-7)9-8(19(21)22)6-15-17-9;1-4-2-3-4/h6-7H,1-5H2,(H,15,17)(H,16,20);4H,2-3H2,1H3 |
| InChIKey | NZDYSZWEHWMNKX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|