C9H15F3OSe — CID 138974150
trans-(1S,2S)-1-ethoxy-2-(trifluoromethylselanyl)cyclohexane (PubChem CID 138974150) has the molecular formula C9H15F3OSe and a molecular weight of 275.17 g/mol. Its IUPAC name is trans-(1S,2S)-1-ethoxy-2-(trifluoromethylselanyl)cyclohexane.
| Compound Name | trans-(1S,2S)-1-ethoxy-2-(trifluoromethylselanyl)cyclohexane |
|---|---|
| PubChem CID | 138974150 |
| Molecular Formula | C9H15F3OSe |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | trans-(1S,2S)-1-ethoxy-2-(trifluoromethylselanyl)cyclohexane |
| SMILES | CCO[C@H]1CCCC[C@@H]1[Se]C(F)(F)F |
| InChI | InChI=1S/C9H15F3OSe/c1-2-13-7-5-3-4-6-8(7)14-9(10,11)12/h7-8H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | UJIPCZOJSUQVLS-YUMQZZPRSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|