C11H17FO2 — CID 138975026
(6-fluoro-3-methyl-2-bicyclo[2.2.1]heptanyl)methyl acetate (PubChem CID 138975026) has the molecular formula C11H17FO2 and a molecular weight of 200.25 g/mol. Its IUPAC name is (6-fluoro-3-methyl-2-bicyclo[2.2.1]heptanyl)methyl acetate.
| Compound Name | (6-fluoro-3-methyl-2-bicyclo[2.2.1]heptanyl)methyl acetate |
|---|---|
| PubChem CID | 138975026 |
| Molecular Formula | C11H17FO2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (6-fluoro-3-methyl-2-bicyclo[2.2.1]heptanyl)methyl acetate |
| SMILES | CC(=O)OCC1C(C)C2CC(F)C1C2 |
| InChI | InChI=1S/C11H17FO2/c1-6-8-3-9(11(12)4-8)10(6)5-14-7(2)13/h6,8-11H,3-5H2,1-2H3 |
| InChIKey | QZLIFKZKGZEZGM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |