C26H24F3N — CID 138975073
(3S,4R)-1-butyl-3,4-diphenyl-6-(trifluoromethyl)-3,4-dihydroisoquinoline (PubChem CID 138975073) has the molecular formula C26H24F3N and a molecular weight of 407.48 g/mol. Its IUPAC name is (3S,4R)-1-butyl-3,4-diphenyl-6-(trifluoromethyl)-3,4-dihydroisoquinoline.
| Compound Name | (3S,4R)-1-butyl-3,4-diphenyl-6-(trifluoromethyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 138975073 |
| Molecular Formula | C26H24F3N |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (3S,4R)-1-butyl-3,4-diphenyl-6-(trifluoromethyl)-3,4-dihydroisoquinoline |
| SMILES | CCCCC1=N[C@H](c2ccccc2)[C@H](c2ccccc2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C26H24F3N/c1-2-3-14-23-21-16-15-20(26(27,28)29)17-22(21)24(18-10-6-4-7-11-18)25(30-23)19-12-8-5-9-13-19/h4-13,15-17,24-25H,2-3,14H2,1H3/t24-,25-/m1/s1 |
| InChIKey | UFZQFPDQSCERRS-JWQCQUIFSA-N |
| XLogP | 7.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |