C17H9F2NO3 — CID 138975279
(2,2-difluoro-1,3-benzodioxol-5-yl)-isoquinolin-1-ylmethanone (PubChem CID 138975279) has the molecular formula C17H9F2NO3 and a molecular weight of 313.26 g/mol. Its IUPAC name is (2,2-difluoro-1,3-benzodioxol-5-yl)-isoquinolin-1-ylmethanone.
| Compound Name | (2,2-difluoro-1,3-benzodioxol-5-yl)-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 138975279 |
| Molecular Formula | C17H9F2NO3 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (2,2-difluoro-1,3-benzodioxol-5-yl)-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1ccc2c(c1)OC(F)(F)O2)c1nccc2ccccc12 |
| InChI | InChI=1S/C17H9F2NO3/c18-17(19)22-13-6-5-11(9-14(13)23-17)16(21)15-12-4-2-1-3-10(12)7-8-20-15/h1-9H |
| InChIKey | XAALEJRPNSIPJQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |