C25H27NO4 — CID 138975577
diethyl 1,6-dimethyl-2,2-diphenylpyridine-3,5-dicarboxylate (PubChem CID 138975577) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is diethyl 1,6-dimethyl-2,2-diphenylpyridine-3,5-dicarboxylate.
| Compound Name | diethyl 1,6-dimethyl-2,2-diphenylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 138975577 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | diethyl 1,6-dimethyl-2,2-diphenylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(C(=O)OCC)=C(C)N(C)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27NO4/c1-5-29-23(27)21-17-22(24(28)30-6-2)25(26(4)18(21)3,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-17H,5-6H2,1-4H3 |
| InChIKey | WVEYWKLFGBGCSX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |