C29H64O5Si3 — CID 138976515
ethyl (7S,8R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]nonanoate (PubChem CID 138976515) has the molecular formula C29H64O5Si3 and a molecular weight of 577.08 g/mol. Its IUPAC name is ethyl (7S,8R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]nonanoate.
| Compound Name | ethyl (7S,8R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]nonanoate |
|---|---|
| PubChem CID | 138976515 |
| Molecular Formula | C29H64O5Si3 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.41 |
| IUPAC Name | ethyl (7S,8R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]nonanoate |
| SMILES | CCOC(=O)CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H64O5Si3/c1-17-31-26(30)22-20-18-19-21-24(33-36(13,14)28(5,6)7)25(34-37(15,16)29(8,9)10)23-32-35(11,12)27(2,3)4/h24-25H,17-23H2,1-16H3/t24-,25+/m0/s1 |
| InChIKey | RNZOVSTUINCIBC-LOSJGSFVSA-N |
| XLogP | 9.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|