C10H16LiNO3 — CID 138976869
lithium (6R,7S,7aS)-7-ethyl-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-olate (PubChem CID 138976869) has the molecular formula C10H16LiNO3 and a molecular weight of 205.18 g/mol. Its IUPAC name is lithium (6R,7S,7aS)-7-ethyl-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-olate.
| Compound Name | lithium (6R,7S,7aS)-7-ethyl-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-olate |
|---|---|
| PubChem CID | 138976869 |
| Molecular Formula | C10H16LiNO3 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | lithium (6R,7S,7aS)-7-ethyl-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-6-olate |
| SMILES | CC[C@H]1[C@H]2COC(C)(C)N2C(=O)[C@@H]1[O-].[Li+] |
| InChI | InChI=1S/C10H16NO3.Li/c1-4-6-7-5-14-10(2,3)11(7)9(13)8(6)12;/h6-8H,4-5H2,1-3H3;/q-1;+1/t6-,7+,8+;/m0./s1 |
| InChIKey | PGWSTWZGGYHJOE-HNPMAXIBSA-N |
| XLogP | -3.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |