C18H21F2NO2 — CID 138977279
3-benzyl-4-(2,2-difluoroethylamino)-1-oxaspiro[4.5]dec-3-en-2-one (PubChem CID 138977279) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is 3-benzyl-4-(2,2-difluoroethylamino)-1-oxaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-benzyl-4-(2,2-difluoroethylamino)-1-oxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 138977279 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-benzyl-4-(2,2-difluoroethylamino)-1-oxaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1OC2(CCCCC2)C(NCC(F)F)=C1Cc1ccccc1 |
| InChI | InChI=1S/C18H21F2NO2/c19-15(20)12-21-16-14(11-13-7-3-1-4-8-13)17(22)23-18(16)9-5-2-6-10-18/h1,3-4,7-8,15,21H,2,5-6,9-12H2 |
| InChIKey | HYIRGMVBUUOHRI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |