C18H20F3NO2 — CID 138977291
4-(methylamino)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxaspiro[4.5]dec-3-en-2-one (PubChem CID 138977291) has the molecular formula C18H20F3NO2 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-(methylamino)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-(methylamino)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 138977291 |
| Molecular Formula | C18H20F3NO2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(methylamino)-3-[[4-(trifluoromethyl)phenyl]methyl]-1-oxaspiro[4.5]dec-3-en-2-one |
| SMILES | CNC1=C(Cc2ccc(C(F)(F)F)cc2)C(=O)OC12CCCCC2 |
| InChI | InChI=1S/C18H20F3NO2/c1-22-15-14(16(23)24-17(15)9-3-2-4-10-17)11-12-5-7-13(8-6-12)18(19,20)21/h5-8,22H,2-4,9-11H2,1H3 |
| InChIKey | CMJLEALEWFAPNR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |