C14H23NO3 — CID 138977960
tert-butyl (5R)-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate (PubChem CID 138977960) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl (5R)-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate.
| Compound Name | tert-butyl (5R)-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate |
|---|---|
| PubChem CID | 138977960 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl (5R)-3'-methylspiro[8-azabicyclo[3.2.1]octane-3,2'-oxirane]-8-carboxylate |
| SMILES | CC1OC12CC1CC[C@H](C2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO3/c1-9-14(17-9)7-10-5-6-11(8-14)15(10)12(16)18-13(2,3)4/h9-11H,5-8H2,1-4H3/t9?,10-,11?,14?/m1/s1 |
| InChIKey | XQVDINAGFXOTIB-DITHJYQYSA-N |
| XLogP | 2.71 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|