C18H23NO5S — CID 138978566
ethyl (5Z)-3-methyl-1-(4-methylphenyl)sulfonyl-2-oxo-5-propylidenepyrrolidine-3-carboxylate (PubChem CID 138978566) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is ethyl (5Z)-3-methyl-1-(4-methylphenyl)sulfonyl-2-oxo-5-propylidenepyrrolidine-3-carboxylate.
| Compound Name | ethyl (5Z)-3-methyl-1-(4-methylphenyl)sulfonyl-2-oxo-5-propylidenepyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 138978566 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | ethyl (5Z)-3-methyl-1-(4-methylphenyl)sulfonyl-2-oxo-5-propylidenepyrrolidine-3-carboxylate |
| SMILES | CC/C=C1/CC(C)(C(=O)OCC)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-5-7-14-12-18(4,17(21)24-6-2)16(20)19(14)25(22,23)15-10-8-13(3)9-11-15/h7-11H,5-6,12H2,1-4H3/b14-7- |
| InChIKey | WTZQIVBPQWLZSZ-AUWJEWJLSA-N |
| XLogP | 2.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|