C25H44O6Si — CID 138978683
ethyl (2Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2,5-dimethoxy-2,5-dihydrofuran-3-yl)propylidene]-6-methylhept-6-enoate (PubChem CID 138978683) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is ethyl (2Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2,5-dimethoxy-2,5-dihydrofuran-3-yl)propylidene]-6-methylhept-6-enoate.
| Compound Name | ethyl (2Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2,5-dimethoxy-2,5-dihydrofuran-3-yl)propylidene]-6-methylhept-6-enoate |
|---|---|
| PubChem CID | 138978683 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | ethyl (2Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-(2,5-dimethoxy-2,5-dihydrofuran-3-yl)propylidene]-6-methylhept-6-enoate |
| SMILES | C=C(C)C[C@H](C/C(=C/CCC1=CC(OC)OC1OC)C(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O6Si/c1-11-29-23(26)19(13-12-14-20-17-22(27-7)30-24(20)28-8)16-21(15-18(2)3)31-32(9,10)25(4,5)6/h13,17,21-22,24H,2,11-12,14-16H2,1,3-10H3/b19-13-/t21-,22?,24?/m1/s1 |
| InChIKey | GNWBZEZMHZCJBI-PODLNWCPSA-N |
| XLogP | 5.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|