C11H16O3 — CID 138978748
ethyl (3aS,6R,6aR)-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate (PubChem CID 138978748) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl (3aS,6R,6aR)-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate.
| Compound Name | ethyl (3aS,6R,6aR)-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate |
|---|---|
| PubChem CID | 138978748 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ethyl (3aS,6R,6aR)-4-methylidene-1,3,3a,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OCC)[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C11H16O3/c1-3-14-11(12)8-4-7(2)9-5-13-6-10(8)9/h8-10H,2-6H2,1H3/t8-,9-,10+/m1/s1 |
| InChIKey | GTSMMZSWIYFZEC-BBBLOLIVSA-N |
| XLogP | 1.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|