C28H34OSi2 — CID 138979074
(E)-1,2-bis[dimethyl(phenyl)silyl]-1-phenylhex-1-en-3-one (PubChem CID 138979074) has the molecular formula C28H34OSi2 and a molecular weight of 442.75 g/mol. Its IUPAC name is (E)-1,2-bis[dimethyl(phenyl)silyl]-1-phenylhex-1-en-3-one.
| Compound Name | (E)-1,2-bis[dimethyl(phenyl)silyl]-1-phenylhex-1-en-3-one |
|---|---|
| PubChem CID | 138979074 |
| Molecular Formula | C28H34OSi2 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (E)-1,2-bis[dimethyl(phenyl)silyl]-1-phenylhex-1-en-3-one |
| SMILES | CCCC(=O)/C(=C(/c1ccccc1)[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H34OSi2/c1-6-16-26(29)28(31(4,5)25-21-14-9-15-22-25)27(23-17-10-7-11-18-23)30(2,3)24-19-12-8-13-20-24/h7-15,17-22H,6,16H2,1-5H3/b28-27+ |
| InChIKey | OBIFWIYDUOPRKR-BYYHNAKLSA-N |
| XLogP | 6.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|