C11H17NO — CID 138980136
(3R,4S)-3,4-bis(but-3-enyl)azetidin-2-one (PubChem CID 138980136) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (3R,4S)-3,4-bis(but-3-enyl)azetidin-2-one.
| Compound Name | (3R,4S)-3,4-bis(but-3-enyl)azetidin-2-one |
|---|---|
| PubChem CID | 138980136 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3R,4S)-3,4-bis(but-3-enyl)azetidin-2-one |
| SMILES | C=CCC[C@@H]1NC(=O)[C@@H]1CCC=C |
| InChI | InChI=1S/C11H17NO/c1-3-5-7-9-10(8-6-4-2)12-11(9)13/h3-4,9-10H,1-2,5-8H2,(H,12,13)/t9-,10+/m1/s1 |
| InChIKey | HJTDQYKLXWLKOJ-ZJUUUORDSA-N |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|