C11H20F3NO2S — CID 138980190
N-[(3R)-6,7-dimethyloct-6-en-3-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 138980190) has the molecular formula C11H20F3NO2S and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[(3R)-6,7-dimethyloct-6-en-3-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(3R)-6,7-dimethyloct-6-en-3-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 138980190 |
| Molecular Formula | C11H20F3NO2S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-[(3R)-6,7-dimethyloct-6-en-3-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC[C@H](CCC(C)=C(C)C)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO2S/c1-5-10(7-6-9(4)8(2)3)15-18(16,17)11(12,13)14/h10,15H,5-7H2,1-4H3/t10-/m1/s1 |
| InChIKey | XWCBVJNHJZPQDK-SNVBAGLBSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|