C12H20F3NO2S — CID 138980335
N-[(3R)-1-(cyclohexen-1-yl)pentan-3-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 138980335) has the molecular formula C12H20F3NO2S and a molecular weight of 299.36 g/mol. Its IUPAC name is N-[(3R)-1-(cyclohexen-1-yl)pentan-3-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[(3R)-1-(cyclohexen-1-yl)pentan-3-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 138980335 |
| Molecular Formula | C12H20F3NO2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[(3R)-1-(cyclohexen-1-yl)pentan-3-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC[C@H](CCC1=CCCCC1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2S/c1-2-11(16-19(17,18)12(13,14)15)9-8-10-6-4-3-5-7-10/h6,11,16H,2-5,7-9H2,1H3/t11-/m1/s1 |
| InChIKey | ZPFBMAHGKRVZKD-LLVKDONJSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|