C9H15F2NO3S — CID 143236351
3-amino-3-(cyclohexen-1-yl)-1,1-difluoropropane-1-sulfonic acid (PubChem CID 143236351) has the molecular formula C9H15F2NO3S and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-amino-3-(cyclohexen-1-yl)-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 3-amino-3-(cyclohexen-1-yl)-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 143236351 |
| Molecular Formula | C9H15F2NO3S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-amino-3-(cyclohexen-1-yl)-1,1-difluoropropane-1-sulfonic acid |
| SMILES | NC(CC(F)(F)S(=O)(=O)O)C1=CCCCC1 |
| InChI | InChI=1S/C9H15F2NO3S/c10-9(11,16(13,14)15)6-8(12)7-4-2-1-3-5-7/h4,8H,1-3,5-6,12H2,(H,13,14,15) |
| InChIKey | JAZKZEBBWYEQGJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|