C9H14F3NO2S — CID 117063867
N-[2-(cyclohexen-1-yl)ethyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 117063867) has the molecular formula C9H14F3NO2S and a molecular weight of 257.28 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 117063867 |
| Molecular Formula | C9H14F3NO2S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCCC1=CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2S/c10-9(11,12)16(14,15)13-7-6-8-4-2-1-3-5-8/h4,13H,1-3,5-7H2 |
| InChIKey | OYHYLFFTFVVXJA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|