C9H16F3NO2S — CID 134875275
1,1,1-trifluoro-N-oct-1-en-4-ylmethanesulfonamide (PubChem CID 134875275) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-oct-1-en-4-ylmethanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-oct-1-en-4-ylmethanesulfonamide |
|---|---|
| PubChem CID | 134875275 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1,1,1-trifluoro-N-oct-1-en-4-ylmethanesulfonamide |
| SMILES | C=CCC(CCCC)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c1-3-5-7-8(6-4-2)13-16(14,15)9(10,11)12/h4,8,13H,2-3,5-7H2,1H3 |
| InChIKey | RMEWOPWCDKPFJJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|