C11H20F3NOS — CID 121006558
(S)-2-methyl-N-[(2S)-1,1,1-trifluorohept-6-en-2-yl]propane-2-sulfinamide (PubChem CID 121006558) has the molecular formula C11H20F3NOS and a molecular weight of 271.35 g/mol. Its IUPAC name is (S)-2-methyl-N-[(2S)-1,1,1-trifluorohept-6-en-2-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(2S)-1,1,1-trifluorohept-6-en-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 121006558 |
| Molecular Formula | C11H20F3NOS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (S)-2-methyl-N-[(2S)-1,1,1-trifluorohept-6-en-2-yl]propane-2-sulfinamide |
| SMILES | C=CCCC[C@H](N[S@@](=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NOS/c1-5-6-7-8-9(11(12,13)14)15-17(16)10(2,3)4/h5,9,15H,1,6-8H2,2-4H3/t9-,17-/m0/s1 |
| InChIKey | LYDVGHWCORLVCC-XYZCENFISA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|