C11H17F3INO2S — CID 177256574
1,1,1-trifluoro-N-(6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)methanesulfonamide (PubChem CID 177256574) has the molecular formula C11H17F3INO2S and a molecular weight of 411.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)methanesulfonamide |
|---|---|
| PubChem CID | 177256574 |
| Molecular Formula | C11H17F3INO2S |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 1,1,1-trifluoro-N-(6-iodo-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl)methanesulfonamide |
| SMILES | CC(C)C1=CC(NS(=O)(=O)C(F)(F)F)C(C)(I)CC1 |
| InChI | InChI=1S/C11H17F3INO2S/c1-7(2)8-4-5-10(3,15)9(6-8)16-19(17,18)11(12,13)14/h6-7,9,16H,4-5H2,1-3H3 |
| InChIKey | KTQLAOXQOMTMIM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|