C25H21NO3 — CID 138980452
ethyl (2R)-2,3,6-triphenyl-2H-1,4-oxazine-5-carboxylate (PubChem CID 138980452) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl (2R)-2,3,6-triphenyl-2H-1,4-oxazine-5-carboxylate.
| Compound Name | ethyl (2R)-2,3,6-triphenyl-2H-1,4-oxazine-5-carboxylate |
|---|---|
| PubChem CID | 138980452 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | ethyl (2R)-2,3,6-triphenyl-2H-1,4-oxazine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)O[C@H](c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C25H21NO3/c1-2-28-25(27)22-24(20-16-10-5-11-17-20)29-23(19-14-8-4-9-15-19)21(26-22)18-12-6-3-7-13-18/h3-17,23H,2H2,1H3/t23-/m1/s1 |
| InChIKey | XDZUWUYWEYDHAV-HSZRJFAPSA-N |
| XLogP | 5.18 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |