C42H20F12N2 — CID 138980814
5,7,12,14-tetrakis[4-(trifluoromethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene (PubChem CID 138980814) has the molecular formula C42H20F12N2 and a molecular weight of 780.61 g/mol. Its IUPAC name is 5,7,12,14-tetrakis[4-(trifluoromethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene.
| Compound Name | 5,7,12,14-tetrakis[4-(trifluoromethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene |
|---|---|
| PubChem CID | 138980814 |
| Molecular Formula | C42H20F12N2 |
| Molecular Weight | 780.61 g/mol |
| Exact Mass | 780.14 |
| IUPAC Name | 5,7,12,14-tetrakis[4-(trifluoromethyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),5,7,9,11,13-octaene |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)c3ccc4c(-c5ccc(C(F)(F)F)cc5)nc(-c5ccc(C(F)(F)F)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C42H20F12N2/c43-39(44,45)25-9-1-21(2-10-25)35-29-17-18-31-34-32(20-19-30(33(29)34)36(55-35)22-3-11-26(12-4-22)40(46,47)48)38(24-7-15-28(16-8-24)42(52,53)54)56-37(31)23-5-13-27(14-6-23)41(49,50)51/h1-20H |
| InChIKey | RCXITOIDKWXBMV-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.61 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|