C31H40B2N2O4 — CID 138981274
1-methyl-3-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 138981274) has the molecular formula C31H40B2N2O4 and a molecular weight of 526.30 g/mol. Its IUPAC name is 1-methyl-3-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-methyl-3-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 138981274 |
| Molecular Formula | C31H40B2N2O4 |
| Molecular Weight | 526.30 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | 1-methyl-3-[[1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-3-yl]methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Cn1cc(Cc2cn(C)c3ccc(B4OC(C)(C)C(C)(C)O4)cc23)c2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C31H40B2N2O4/c1-28(2)29(3,4)37-32(36-28)22-11-13-26-24(16-22)20(18-34(26)9)15-21-19-35(10)27-14-12-23(17-25(21)27)33-38-30(5,6)31(7,8)39-33/h11-14,16-19H,15H2,1-10H3 |
| InChIKey | RQSMYNFFTLZGFP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 46.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|