C17H30O4Si — CID 138982935
methyl (3R,3aR,6R,8aS)-3,6-dimethyl-8-oxo-8a-trimethylsilyloxy-2,3,4,5,6,7-hexahydro-1H-azulene-3a-carboxylate (PubChem CID 138982935) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is methyl (3R,3aR,6R,8aS)-3,6-dimethyl-8-oxo-8a-trimethylsilyloxy-2,3,4,5,6,7-hexahydro-1H-azulene-3a-carboxylate.
| Compound Name | methyl (3R,3aR,6R,8aS)-3,6-dimethyl-8-oxo-8a-trimethylsilyloxy-2,3,4,5,6,7-hexahydro-1H-azulene-3a-carboxylate |
|---|---|
| PubChem CID | 138982935 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | methyl (3R,3aR,6R,8aS)-3,6-dimethyl-8-oxo-8a-trimethylsilyloxy-2,3,4,5,6,7-hexahydro-1H-azulene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@@H](C)CC(=O)[C@]1(O[Si](C)(C)C)CC[C@H]2C |
| InChI | InChI=1S/C17H30O4Si/c1-12-7-9-16(15(19)20-3)13(2)8-10-17(16,14(18)11-12)21-22(4,5)6/h12-13H,7-11H2,1-6H3/t12-,13-,16+,17-/m1/s1 |
| InChIKey | ONFHCRDRVXCQLM-UTJXIGIESA-N |
| XLogP | 3.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|