C22H40O4Si — CID 10949316
ethyl 2-[(3S,3aS,5S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-4-oxo-1,2,3,5,6,7,8,8a-octahydroazulen-5-yl]acetate (PubChem CID 10949316) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is ethyl 2-[(3S,3aS,5S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-4-oxo-1,2,3,5,6,7,8,8a-octahydroazulen-5-yl]acetate.
| Compound Name | ethyl 2-[(3S,3aS,5S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-4-oxo-1,2,3,5,6,7,8,8a-octahydroazulen-5-yl]acetate |
|---|---|
| PubChem CID | 10949316 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl 2-[(3S,3aS,5S,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-4-oxo-1,2,3,5,6,7,8,8a-octahydroazulen-5-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC[C@H](C)[C@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C1=O |
| InChI | InChI=1S/C22H40O4Si/c1-9-25-19(23)14-16-11-10-15(2)17-12-13-18(22(17,6)20(16)24)26-27(7,8)21(3,4)5/h15-18H,9-14H2,1-8H3/t15-,16-,17+,18-,22-/m0/s1 |
| InChIKey | XTAWXTXNPYIRTI-ARNOYJHMSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|