C18H34O2Si — CID 11056021
(3S,3aS,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one (PubChem CID 11056021) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (3S,3aS,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one.
| Compound Name | (3S,3aS,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one |
|---|---|
| PubChem CID | 11056021 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (3S,3aS,8S,8aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,8-dimethyl-1,2,3,5,6,7,8,8a-octahydroazulen-4-one |
| SMILES | C[C@H]1CCCC(=O)[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C18H34O2Si/c1-13-9-8-10-15(19)18(5)14(13)11-12-16(18)20-21(6,7)17(2,3)4/h13-14,16H,8-12H2,1-7H3/t13-,14+,16-,18+/m0/s1 |
| InChIKey | PEUSQYFRBQPPPB-JSSFPYSZSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|