C23H40O5Si — CID 134839599
ethyl 4-[(1R,3aR,4R,6R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-6-yl]-3-oxobutanoate (PubChem CID 134839599) has the molecular formula C23H40O5Si and a molecular weight of 424.65 g/mol. Its IUPAC name is ethyl 4-[(1R,3aR,4R,6R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-6-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[(1R,3aR,4R,6R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-6-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 134839599 |
| Molecular Formula | C23H40O5Si |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | ethyl 4-[(1R,3aR,4R,6R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-6-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CC[C@@H](C)[C@H]2CC1=O |
| InChI | InChI=1S/C23H40O5Si/c1-8-27-22(26)13-17(24)11-16-12-21(28-29(6,7)23(3,4)5)18-10-9-15(2)19(18)14-20(16)25/h15-16,18-19,21H,8-14H2,1-7H3/t15-,16+,18-,19-,21-/m1/s1 |
| InChIKey | LEABBNJMKTZRRS-BKRRIZPZSA-N |
| XLogP | 4.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|