C19H36O4Si — CID 14270549
ethyl 2-[(1S,2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propylcyclopentyl]acetate (PubChem CID 14270549) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propylcyclopentyl]acetate.
| Compound Name | ethyl 2-[(1S,2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propylcyclopentyl]acetate |
|---|---|
| PubChem CID | 14270549 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl 2-[(1S,2R,3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-2-propylcyclopentyl]acetate |
| SMILES | CCC[C@@H]1[C@H](CO[Si](C)(C)C(C)(C)C)CC(=O)[C@H]1CC(=O)OCC |
| InChI | InChI=1S/C19H36O4Si/c1-8-10-15-14(13-23-24(6,7)19(3,4)5)11-17(20)16(15)12-18(21)22-9-2/h14-16H,8-13H2,1-7H3/t14-,15+,16-/m0/s1 |
| InChIKey | RHKMWXVRAVOKPJ-XHSDSOJGSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|