C25H20F3N3O2 — CID 138983629
2-(4-methoxyphenyl)-6-methyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide (PubChem CID 138983629) has the molecular formula C25H20F3N3O2 and a molecular weight of 451.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-methyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide.
| Compound Name | 2-(4-methoxyphenyl)-6-methyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 138983629 |
| Molecular Formula | C25H20F3N3O2 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-methyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]phenyl]benzamide |
| SMILES | COc1ccc(-c2cccc(C)c2C(=O)Nc2ccccc2-n2ccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C25H20F3N3O2/c1-16-6-5-7-19(17-10-12-18(33-2)13-11-17)23(16)24(32)29-20-8-3-4-9-21(20)31-15-14-22(30-31)25(26,27)28/h3-15H,1-2H3,(H,29,32) |
| InChIKey | XJZJGEJNOFURER-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |