C29H25OPS — CID 138984122
(4-diphenylphosphoryl-3-phenylsulfanylpenta-2,4-dien-2-yl)benzene (PubChem CID 138984122) has the molecular formula C29H25OPS and a molecular weight of 452.56 g/mol. Its IUPAC name is (4-diphenylphosphoryl-3-phenylsulfanylpenta-2,4-dien-2-yl)benzene.
| Compound Name | (4-diphenylphosphoryl-3-phenylsulfanylpenta-2,4-dien-2-yl)benzene |
|---|---|
| PubChem CID | 138984122 |
| Molecular Formula | C29H25OPS |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (4-diphenylphosphoryl-3-phenylsulfanylpenta-2,4-dien-2-yl)benzene |
| SMILES | C=C(C(Sc1ccccc1)=C(C)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25OPS/c1-23(25-15-7-3-8-16-25)29(32-28-21-13-6-14-22-28)24(2)31(30,26-17-9-4-10-18-26)27-19-11-5-12-20-27/h3-22H,2H2,1H3 |
| InChIKey | RJAOXUBOLUZVIP-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|