C19H25NO4 — CID 138984579
(1S,4S,13S,14S)-10,13-dimethoxy-5-methyl-12-oxa-5-azapentacyclo[11.3.1.11,4.02,11.03,8]octadeca-2,8,10-trien-14-ol (PubChem CID 138984579) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (1S,4S,13S,14S)-10,13-dimethoxy-5-methyl-12-oxa-5-azapentacyclo[11.3.1.11,4.02,11.03,8]octadeca-2,8,10-trien-14-ol.
| Compound Name | (1S,4S,13S,14S)-10,13-dimethoxy-5-methyl-12-oxa-5-azapentacyclo[11.3.1.11,4.02,11.03,8]octadeca-2,8,10-trien-14-ol |
|---|---|
| PubChem CID | 138984579 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (1S,4S,13S,14S)-10,13-dimethoxy-5-methyl-12-oxa-5-azapentacyclo[11.3.1.11,4.02,11.03,8]octadeca-2,8,10-trien-14-ol |
| SMILES | COc1cc2c3c4c1O[C@@]1(OC)C[C@]4(CC[C@@H]1O)C[C@@H]3N(C)CC2 |
| InChI | InChI=1S/C19H25NO4/c1-20-7-5-11-8-13(22-2)17-16-15(11)12(20)9-18(16)6-4-14(21)19(10-18,23-3)24-17/h8,12,14,21H,4-7,9-10H2,1-3H3/t12-,14-,18-,19-/m0/s1 |
| InChIKey | RQLOGQPJLCEFLE-XGHOKTPJSA-N |
| XLogP | 2.15 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |