C11H8BrF3 — CID 138984715
1-bromo-4-(5,5,5-trifluoropent-1-yn-3-yl)benzene (PubChem CID 138984715) has the molecular formula C11H8BrF3 and a molecular weight of 277.08 g/mol. Its IUPAC name is 1-bromo-4-(5,5,5-trifluoropent-1-yn-3-yl)benzene.
| Compound Name | 1-bromo-4-(5,5,5-trifluoropent-1-yn-3-yl)benzene |
|---|---|
| PubChem CID | 138984715 |
| Molecular Formula | C11H8BrF3 |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 1-bromo-4-(5,5,5-trifluoropent-1-yn-3-yl)benzene |
| SMILES | C#CC(CC(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H8BrF3/c1-2-8(7-11(13,14)15)9-3-5-10(12)6-4-9/h1,3-6,8H,7H2 |
| InChIKey | MXNYJACQXQWTFX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|