C18H22BrN3O3S — CID 138988558
5-bromo-2-[[1-[(3-methylphenyl)methylsulfonyl]piperidin-3-yl]methoxy]pyrimidine (PubChem CID 138988558) has the molecular formula C18H22BrN3O3S and a molecular weight of 440.36 g/mol. Its IUPAC name is 5-bromo-2-[[1-[(3-methylphenyl)methylsulfonyl]piperidin-3-yl]methoxy]pyrimidine.
| Compound Name | 5-bromo-2-[[1-[(3-methylphenyl)methylsulfonyl]piperidin-3-yl]methoxy]pyrimidine |
|---|---|
| PubChem CID | 138988558 |
| Molecular Formula | C18H22BrN3O3S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 5-bromo-2-[[1-[(3-methylphenyl)methylsulfonyl]piperidin-3-yl]methoxy]pyrimidine |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCCC(COc3ncc(Br)cn3)C2)c1 |
| InChI | InChI=1S/C18H22BrN3O3S/c1-14-4-2-5-15(8-14)13-26(23,24)22-7-3-6-16(11-22)12-25-18-20-9-17(19)10-21-18/h2,4-5,8-10,16H,3,6-7,11-13H2,1H3 |
| InChIKey | YVSCOWPPWYAUHB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |