(1-methylcyclopropyl)methanesulfonyl fluoride

C5H9FO2S — CID 138989246

IUPAC(1-methylcyclopropyl)methanesulfonyl fluoride
SMILESCC1(CS(=O)(=O)F)CC1
InChIInChI=1S/C5H9FO2S/c1-5(2-3-5)4-9(6,7)8/h2-4H2,1H3
InChIKeyLQNNKIZQFLCUKJ-UHFFFAOYSA-N
MW152.19 g/mol
LogP1.09
Rot. Bonds2

About (1-methylcyclopropyl)methanesulfonyl fluoride

(1-methylcyclopropyl)methanesulfonyl fluoride (PubChem CID 138989246) has the molecular formula C5H9FO2S and a molecular weight of 152.19 g/mol. Its IUPAC name is (1-methylcyclopropyl)methanesulfonyl fluoride.

Molecular Properties

Compound Name(1-methylcyclopropyl)methanesulfonyl fluoride
PubChem CID138989246
Molecular FormulaC5H9FO2S
Molecular Weight152.19 g/mol
Exact Mass152.03
IUPAC Name(1-methylcyclopropyl)methanesulfonyl fluoride
SMILESCC1(CS(=O)(=O)F)CC1
InChIInChI=1S/C5H9FO2S/c1-5(2-3-5)4-9(6,7)8/h2-4H2,1H3
InChIKeyLQNNKIZQFLCUKJ-UHFFFAOYSA-N
XLogP1.09
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.19
LogP ≤ 51.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (1-methylcyclopropyl)methanesulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Methylbutane-1-sulfonyl fluoride
CID 22935853
(1-Methylcyclopropyl)methanesulfonyl chloride
CID 55262941
2,2-Dimethylcyclopropane-1-sulfonyl chloride
CID 137944046
3,3-Dimethylbutane-1-sulfonyl fluoride
CID 54593040
(2-Methylcyclopropyl)methanesulfonyl fluoride
CID 139022381
3-Methylbutane-1-sulfonyl fluoride
CID 87773919
2,2-Dimethylpropane-1-sulfonyl fluoride
CID 115011968
2,2-Dimethylcyclopropane-1-sulfonyl fluoride
CID 139363293
2-Methylcyclopropane-1-sulfonyl fluoride
CID 139363295
Methyl [1-(fluoromethyl)cyclopropyl]methanesulfonate
CID 175517541
[1-(Fluoromethyl)cyclopropyl]methanesulfonyl chloride
CID 55262831
(2R)-2-methylbutane-1-sulfonyl fluoride
CID 98124569

Frequently Asked Questions

What is the IUPAC name of (1-methylcyclopropyl)methanesulfonyl fluoride?
The IUPAC name of (1-methylcyclopropyl)methanesulfonyl fluoride (CID 138989246) is (1-methylcyclopropyl)methanesulfonyl fluoride.
What is the SMILES notation for (1-methylcyclopropyl)methanesulfonyl fluoride?
The canonical SMILES for (1-methylcyclopropyl)methanesulfonyl fluoride is CC1(CS(=O)(=O)F)CC1.
What is the InChIKey of (1-methylcyclopropyl)methanesulfonyl fluoride?
The InChIKey is LQNNKIZQFLCUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO2S/c1-5(2-3-5)4-9(6,7)8/h2-4H2,1H3.
What are the key properties of (1-methylcyclopropyl)methanesulfonyl fluoride?
(1-methylcyclopropyl)methanesulfonyl fluoride has a molecular weight of 152.19 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl)methanesulfonyl fluoride is sourced from PubChem (CID 138989246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).