C11H22ClNO2 — CID 138991548
ethyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride (PubChem CID 138991548) has the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. Its IUPAC name is ethyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride.
| Compound Name | ethyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 138991548 |
| Molecular Formula | C11H22ClNO2 |
| Molecular Weight | 235.75 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | ethyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(N)CC(C(C)(C)C)C1.Cl |
| InChI | InChI=1S/C11H21NO2.ClH/c1-5-14-9(13)11(12)6-8(7-11)10(2,3)4;/h8H,5-7,12H2,1-4H3;1H |
| InChIKey | CBLBVDANJLWGDM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |