C10H20ClNO2 — CID 155858326
methyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride (PubChem CID 155858326) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is methyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride.
| Compound Name | methyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 155858326 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | methyl 1-amino-3-tert-butylcyclobutane-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1(N)CC(C(C)(C)C)C1.Cl |
| InChI | InChI=1S/C10H19NO2.ClH/c1-9(2,3)7-5-10(11,6-7)8(12)13-4;/h7H,5-6,11H2,1-4H3;1H |
| InChIKey | ANHHVNUARNZRCQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |