C17H17N5O2S — CID 138992263
4-oxo-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-3H-phthalazine-1-carboxamide (PubChem CID 138992263) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-oxo-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 138992263 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-oxo-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]-3H-phthalazine-1-carboxamide |
| SMILES | O=C(NC1CCN(c2nccs2)CC1)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H17N5O2S/c23-15-13-4-2-1-3-12(13)14(20-21-15)16(24)19-11-5-8-22(9-6-11)17-18-7-10-25-17/h1-4,7,10-11H,5-6,8-9H2,(H,19,24)(H,21,23) |
| InChIKey | GCTBFWPJZCMFFO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |