C23H28N2O4S — CID 138992541
2-phenoxy-2-phenyl-1-(4-pyrrolidin-1-ylsulfonylpiperidin-1-yl)ethanone (PubChem CID 138992541) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-phenoxy-2-phenyl-1-(4-pyrrolidin-1-ylsulfonylpiperidin-1-yl)ethanone.
| Compound Name | 2-phenoxy-2-phenyl-1-(4-pyrrolidin-1-ylsulfonylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 138992541 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-phenoxy-2-phenyl-1-(4-pyrrolidin-1-ylsulfonylpiperidin-1-yl)ethanone |
| SMILES | O=C(C(Oc1ccccc1)c1ccccc1)N1CCC(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C23H28N2O4S/c26-23(22(19-9-3-1-4-10-19)29-20-11-5-2-6-12-20)24-17-13-21(14-18-24)30(27,28)25-15-7-8-16-25/h1-6,9-12,21-22H,7-8,13-18H2 |
| InChIKey | UYTDHYOMSXXOEE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |