C15H24N4O2 — CID 138993644
3-[2-[[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]amino]ethoxy]propanenitrile (PubChem CID 138993644) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[2-[[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]amino]ethoxy]propanenitrile.
| Compound Name | 3-[2-[[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]amino]ethoxy]propanenitrile |
|---|---|
| PubChem CID | 138993644 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-[2-[[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]amino]ethoxy]propanenitrile |
| SMILES | Cc1nc(C2(NCCOCCC#N)CCCCCC2)no1 |
| InChI | InChI=1S/C15H24N4O2/c1-13-18-14(19-21-13)15(7-4-2-3-5-8-15)17-10-12-20-11-6-9-16/h17H,2-8,10-12H2,1H3 |
| InChIKey | PZWNSSCPFZRVMH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|