C16H27N3O3 — CID 127838387
1-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[2-(oxan-2-yloxy)ethyl]cyclohexan-1-amine (PubChem CID 127838387) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[2-(oxan-2-yloxy)ethyl]cyclohexan-1-amine.
| Compound Name | 1-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[2-(oxan-2-yloxy)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 127838387 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-(5-methyl-1,2,4-oxadiazol-3-yl)-N-[2-(oxan-2-yloxy)ethyl]cyclohexan-1-amine |
| SMILES | Cc1nc(C2(NCCOC3CCCCO3)CCCCC2)no1 |
| InChI | InChI=1S/C16H27N3O3/c1-13-18-15(19-22-13)16(8-4-2-5-9-16)17-10-12-21-14-7-3-6-11-20-14/h14,17H,2-12H2,1H3 |
| InChIKey | KIUDQHRPYYIIPT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|