C18H31N3OS — CID 154795040
N-(2-cyclohexylsulfanylethyl)-1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine (PubChem CID 154795040) has the molecular formula C18H31N3OS and a molecular weight of 337.53 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 154795040 |
| Molecular Formula | C18H31N3OS |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-1-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)cyclopentan-1-amine |
| SMILES | CC(C)c1nc(C2(NCCSC3CCCCC3)CCCC2)no1 |
| InChI | InChI=1S/C18H31N3OS/c1-14(2)16-20-17(21-22-16)18(10-6-7-11-18)19-12-13-23-15-8-4-3-5-9-15/h14-15,19H,3-13H2,1-2H3 |
| InChIKey | DTXNSDRVMBNVCP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|